C17H13ClN4O4S — CID 8643911
N-[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]-2-[(2-nitro-3-pyridinyl)oxy]acetamide (PubChem CID 8643911) has the molecular formula C17H13ClN4O4S and a molecular weight of 404.84 g/mol. Its IUPAC name is N-[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]-2-[(2-nitro-3-pyridinyl)oxy]acetamide.
| Compound Name | N-[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]-2-[(2-nitro-3-pyridinyl)oxy]acetamide |
|---|---|
| PubChem CID | 8643911 |
| Molecular Formula | C17H13ClN4O4S |
| Molecular Weight | 404.84 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | N-[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]-2-[(2-nitro-3-pyridinyl)oxy]acetamide |
| SMILES | O=C(COc1cccnc1[N+](=O)[O-])/N=c1\sccn1Cc1ccccc1Cl |
| InChI | InChI=1S/C17H13ClN4O4S/c18-13-5-2-1-4-12(13)10-21-8-9-27-17(21)20-15(23)11-26-14-6-3-7-19-16(14)22(24)25/h1-9H,10-11H2/b20-17- |
| InChIKey | DIFNEYOTDZIJDT-JZJYNLBNSA-N |
| XLogP | 3.06 |
| TPSA | 99.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.84 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|