C18H17ClN2O3S — CID 16525232
[2-[[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]amino]-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate (PubChem CID 16525232) has the molecular formula C18H17ClN2O3S and a molecular weight of 376.87 g/mol. Its IUPAC name is [2-[[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]amino]-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate.
| Compound Name | [2-[[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]amino]-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 16525232 |
| Molecular Formula | C18H17ClN2O3S |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | [2-[[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]amino]-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)OCC(=O)/N=c1\sccn1Cc1ccccc1Cl |
| InChI | InChI=1S/C18H17ClN2O3S/c1-2-3-4-9-17(23)24-13-16(22)20-18-21(10-11-25-18)12-14-7-5-6-8-15(14)19/h2-11H,12-13H2,1H3/b3-2+,9-4+,20-18- |
| InChIKey | XIKQWVFLHDZKHN-HZAUZEHCSA-N |
| XLogP | 3.35 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|