C17H20ClN3OS3 — CID 2497795
[2-[[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]amino]-2-oxoethyl] N,N-diethylcarbamodithioate (PubChem CID 2497795) has the molecular formula C17H20ClN3OS3 and a molecular weight of 414.02 g/mol. Its IUPAC name is [2-[[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]amino]-2-oxoethyl] N,N-diethylcarbamodithioate.
| Compound Name | [2-[[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]amino]-2-oxoethyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 2497795 |
| Molecular Formula | C17H20ClN3OS3 |
| Molecular Weight | 414.02 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | [2-[[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]amino]-2-oxoethyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCC(=O)/N=c1\sccn1Cc1ccccc1Cl |
| InChI | InChI=1S/C17H20ClN3OS3/c1-3-20(4-2)17(23)25-12-15(22)19-16-21(9-10-24-16)11-13-7-5-6-8-14(13)18/h5-10H,3-4,11-12H2,1-2H3/b19-16- |
| InChIKey | UCAUTGAIXFKQNR-MNDPQUGUSA-N |
| XLogP | 4.04 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.02 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|