C18H19ClN4O3S — CID 60599665
N-[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide (PubChem CID 60599665) has the molecular formula C18H19ClN4O3S and a molecular weight of 406.90 g/mol. Its IUPAC name is N-[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide.
| Compound Name | N-[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 60599665 |
| Molecular Formula | C18H19ClN4O3S |
| Molecular Weight | 406.90 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | N-[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide |
| SMILES | CN1CC(=O)N(CCCC(=O)/N=c2\sccn2Cc2ccccc2Cl)C1=O |
| InChI | InChI=1S/C18H19ClN4O3S/c1-21-12-16(25)23(18(21)26)8-4-7-15(24)20-17-22(9-10-27-17)11-13-5-2-3-6-14(13)19/h2-3,5-6,9-10H,4,7-8,11-12H2,1H3/b20-17- |
| InChIKey | CYHGJCDOAXBDDM-JZJYNLBNSA-N |
| XLogP | 2.35 |
| TPSA | 74.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.90 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|