C16H18ClN3O2S2 — CID 9054250
methyl 4-[[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]carbamothioylamino]butanoate (PubChem CID 9054250) has the molecular formula C16H18ClN3O2S2 and a molecular weight of 383.93 g/mol. Its IUPAC name is methyl 4-[[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]carbamothioylamino]butanoate.
| Compound Name | methyl 4-[[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 9054250 |
| Molecular Formula | C16H18ClN3O2S2 |
| Molecular Weight | 383.93 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | methyl 4-[[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]carbamothioylamino]butanoate |
| SMILES | COC(=O)CCCNC(=S)N=c1sccn1Cc1ccccc1Cl |
| InChI | InChI=1S/C16H18ClN3O2S2/c1-22-14(21)7-4-8-18-15(23)19-16-20(9-10-24-16)11-12-5-2-3-6-13(12)17/h2-3,5-6,9-10H,4,7-8,11H2,1H3,(H,18,23) |
| InChIKey | YLXPTJGNARPYFN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.93 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|