C15H21N4S2+ — CID 9098391
2-[(3-benzyl-1,3-thiazol-2-ylidene)carbamothioylamino]ethyl-dimethylazanium (PubChem CID 9098391) has the molecular formula C15H21N4S2+ and a molecular weight of 321.50 g/mol. Its IUPAC name is 2-[(3-benzyl-1,3-thiazol-2-ylidene)carbamothioylamino]ethyl-dimethylazanium.
| Compound Name | 2-[(3-benzyl-1,3-thiazol-2-ylidene)carbamothioylamino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 9098391 |
| Molecular Formula | C15H21N4S2+ |
| Molecular Weight | 321.50 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 2-[(3-benzyl-1,3-thiazol-2-ylidene)carbamothioylamino]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CCNC(=S)N=c1sccn1Cc1ccccc1 |
| InChI | InChI=1S/C15H20N4S2/c1-18(2)9-8-16-14(20)17-15-19(10-11-21-15)12-13-6-4-3-5-7-13/h3-7,10-11H,8-9,12H2,1-2H3,(H,16,20)/p+1 |
| InChIKey | QYSJKSIEUCYYNA-UHFFFAOYSA-O |
| XLogP | 0.52 |
| TPSA | 33.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.50 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|