C17H21FN4OS2 — CID 9096831
1-[3-[(2-fluorophenyl)methyl]-1,3-thiazol-2-ylidene]-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 9096831) has the molecular formula C17H21FN4OS2 and a molecular weight of 380.51 g/mol. Its IUPAC name is 1-[3-[(2-fluorophenyl)methyl]-1,3-thiazol-2-ylidene]-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[3-[(2-fluorophenyl)methyl]-1,3-thiazol-2-ylidene]-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 9096831 |
| Molecular Formula | C17H21FN4OS2 |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 1-[3-[(2-fluorophenyl)methyl]-1,3-thiazol-2-ylidene]-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | Fc1ccccc1Cn1ccsc1=NC(=S)NCCN1CCOCC1 |
| InChI | InChI=1S/C17H21FN4OS2/c18-15-4-2-1-3-14(15)13-22-9-12-25-17(22)20-16(24)19-5-6-21-7-10-23-11-8-21/h1-4,9,12H,5-8,10-11,13H2,(H,19,24) |
| InChIKey | VTFWSGGQCXHWBP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 41.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|