C14H14ClN3S2 — CID 42913202
(1Z)-1-[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]-3-cyclopropylthiourea (PubChem CID 42913202) has the molecular formula C14H14ClN3S2 and a molecular weight of 323.87 g/mol. Its IUPAC name is (1Z)-1-[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]-3-cyclopropylthiourea.
| Compound Name | (1Z)-1-[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]-3-cyclopropylthiourea |
|---|---|
| PubChem CID | 42913202 |
| Molecular Formula | C14H14ClN3S2 |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | (1Z)-1-[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]-3-cyclopropylthiourea |
| SMILES | S=C(/N=c1\sccn1Cc1ccccc1Cl)NC1CC1 |
| InChI | InChI=1S/C14H14ClN3S2/c15-12-4-2-1-3-10(12)9-18-7-8-20-14(18)17-13(19)16-11-5-6-11/h1-4,7-8,11H,5-6,9H2,(H,16,19)/b17-14- |
| InChIKey | AMVFCRTWEAXISG-VKAVYKQESA-N |
| XLogP | 3.19 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|