C14H17N3S2 — CID 9098389
1-(3-benzyl-1,3-thiazol-2-ylidene)-3-propan-2-ylthiourea (PubChem CID 9098389) has the molecular formula C14H17N3S2 and a molecular weight of 291.45 g/mol. Its IUPAC name is 1-(3-benzyl-1,3-thiazol-2-ylidene)-3-propan-2-ylthiourea.
| Compound Name | 1-(3-benzyl-1,3-thiazol-2-ylidene)-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 9098389 |
| Molecular Formula | C14H17N3S2 |
| Molecular Weight | 291.45 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 1-(3-benzyl-1,3-thiazol-2-ylidene)-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)N=c1sccn1Cc1ccccc1 |
| InChI | InChI=1S/C14H17N3S2/c1-11(2)15-13(18)16-14-17(8-9-19-14)10-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3,(H,15,18) |
| InChIKey | AUOYODLTPVUHCC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|