C15H18FN3S3 — CID 9096846
1-[3-[(2-fluorophenyl)methyl]-1,3-thiazol-2-ylidene]-3-(3-methylsulfanylpropyl)thiourea (PubChem CID 9096846) has the molecular formula C15H18FN3S3 and a molecular weight of 355.53 g/mol. Its IUPAC name is 1-[3-[(2-fluorophenyl)methyl]-1,3-thiazol-2-ylidene]-3-(3-methylsulfanylpropyl)thiourea.
| Compound Name | 1-[3-[(2-fluorophenyl)methyl]-1,3-thiazol-2-ylidene]-3-(3-methylsulfanylpropyl)thiourea |
|---|---|
| PubChem CID | 9096846 |
| Molecular Formula | C15H18FN3S3 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 1-[3-[(2-fluorophenyl)methyl]-1,3-thiazol-2-ylidene]-3-(3-methylsulfanylpropyl)thiourea |
| SMILES | CSCCCNC(=S)N=c1sccn1Cc1ccccc1F |
| InChI | InChI=1S/C15H18FN3S3/c1-21-9-4-7-17-14(20)18-15-19(8-10-22-15)11-12-5-2-3-6-13(12)16/h2-3,5-6,8,10H,4,7,9,11H2,1H3,(H,17,20) |
| InChIKey | VRRNLWCDTRTRBP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|