C17H24ClNO4 — CID 94813622
(2S)-N-[2-[(2-chlorophenyl)methoxy]ethyl]-2-[[(2R)-oxolan-2-yl]methoxy]propanamide (PubChem CID 94813622) has the molecular formula C17H24ClNO4 and a molecular weight of 341.84 g/mol. Its IUPAC name is (2S)-N-[2-[(2-chlorophenyl)methoxy]ethyl]-2-[[(2R)-oxolan-2-yl]methoxy]propanamide.
| Compound Name | (2S)-N-[2-[(2-chlorophenyl)methoxy]ethyl]-2-[[(2R)-oxolan-2-yl]methoxy]propanamide |
|---|---|
| PubChem CID | 94813622 |
| Molecular Formula | C17H24ClNO4 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (2S)-N-[2-[(2-chlorophenyl)methoxy]ethyl]-2-[[(2R)-oxolan-2-yl]methoxy]propanamide |
| SMILES | C[C@H](OC[C@H]1CCCO1)C(=O)NCCOCc1ccccc1Cl |
| InChI | InChI=1S/C17H24ClNO4/c1-13(23-12-15-6-4-9-22-15)17(20)19-8-10-21-11-14-5-2-3-7-16(14)18/h2-3,5,7,13,15H,4,6,8-12H2,1H3,(H,19,20)/t13-,15+/m0/s1 |
| InChIKey | WUPKFSQZWSPXLL-DZGCQCFKSA-N |
| XLogP | 2.56 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|