C14H19N3O5 — CID 95281197
(2R)-N'-(2-nitrophenyl)-2-[[(2R)-oxolan-2-yl]methoxy]propanehydrazide (PubChem CID 95281197) has the molecular formula C14H19N3O5 and a molecular weight of 309.32 g/mol. Its IUPAC name is (2R)-N'-(2-nitrophenyl)-2-[[(2R)-oxolan-2-yl]methoxy]propanehydrazide.
| Compound Name | (2R)-N'-(2-nitrophenyl)-2-[[(2R)-oxolan-2-yl]methoxy]propanehydrazide |
|---|---|
| PubChem CID | 95281197 |
| Molecular Formula | C14H19N3O5 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | (2R)-N'-(2-nitrophenyl)-2-[[(2R)-oxolan-2-yl]methoxy]propanehydrazide |
| SMILES | C[C@@H](OC[C@H]1CCCO1)C(=O)NNc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H19N3O5/c1-10(22-9-11-5-4-8-21-11)14(18)16-15-12-6-2-3-7-13(12)17(19)20/h2-3,6-7,10-11,15H,4-5,8-9H2,1H3,(H,16,18)/t10-,11-/m1/s1 |
| InChIKey | IZWUEYOHKCOUPF-GHMZBOCLSA-N |
| XLogP | 1.62 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|