C14H19N3O2S — CID 18316350
3-butyl-N-(2-methyl-4-nitrophenyl)-1,3-thiazolidin-2-imine (PubChem CID 18316350) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is 3-butyl-N-(2-methyl-4-nitrophenyl)-1,3-thiazolidin-2-imine.
| Compound Name | 3-butyl-N-(2-methyl-4-nitrophenyl)-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 18316350 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 3-butyl-N-(2-methyl-4-nitrophenyl)-1,3-thiazolidin-2-imine |
| SMILES | CCCCN1CCS/C1=N\c1ccc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C14H19N3O2S/c1-3-4-7-16-8-9-20-14(16)15-13-6-5-12(17(18)19)10-11(13)2/h5-6,10H,3-4,7-9H2,1-2H3/b15-14- |
| InChIKey | OTYCBAKKKICPPD-PFONDFGASA-N |
| XLogP | 3.74 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|