C11H13N3O3S — CID 22951404
N-(2-methoxy-4-nitrophenyl)-3-methyl-1,3-thiazolidin-2-imine (PubChem CID 22951404) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is N-(2-methoxy-4-nitrophenyl)-3-methyl-1,3-thiazolidin-2-imine.
| Compound Name | N-(2-methoxy-4-nitrophenyl)-3-methyl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 22951404 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | N-(2-methoxy-4-nitrophenyl)-3-methyl-1,3-thiazolidin-2-imine |
| SMILES | COc1cc([N+](=O)[O-])ccc1/N=C1\SCCN1C |
| InChI | InChI=1S/C11H13N3O3S/c1-13-5-6-18-11(13)12-9-4-3-8(14(15)16)7-10(9)17-2/h3-4,7H,5-6H2,1-2H3/b12-11- |
| InChIKey | UXEAIQRNPCCOSS-QXMHVHEDSA-N |
| XLogP | 2.27 |
| TPSA | 67.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|