C18H27N3O2 — CID 59121934
3,3,5-trimethyl-N-(2-methyl-4-nitrophenyl)-1-(2-methylpropyl)pyrrolidin-2-imine (PubChem CID 59121934) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 3,3,5-trimethyl-N-(2-methyl-4-nitrophenyl)-1-(2-methylpropyl)pyrrolidin-2-imine.
| Compound Name | 3,3,5-trimethyl-N-(2-methyl-4-nitrophenyl)-1-(2-methylpropyl)pyrrolidin-2-imine |
|---|---|
| PubChem CID | 59121934 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 3,3,5-trimethyl-N-(2-methyl-4-nitrophenyl)-1-(2-methylpropyl)pyrrolidin-2-imine |
| SMILES | Cc1cc([N+](=O)[O-])ccc1/N=C1/N(CC(C)C)C(C)CC1(C)C |
| InChI | InChI=1S/C18H27N3O2/c1-12(2)11-20-14(4)10-18(5,6)17(20)19-16-8-7-15(21(22)23)9-13(16)3/h7-9,12,14H,10-11H2,1-6H3/b19-17+ |
| InChIKey | JOZFFJMPKGXWKI-HTXNQAPBSA-N |
| XLogP | 4.71 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|