C20H31N3O3S — CID 59113106
(4S)-N-(2-methyl-4-nitrophenyl)-4-[(1S)-1-[(2-methylpropan-2-yl)oxy]ethyl]-3-(2-methylpropyl)-1,3-thiazolidin-2-imine (PubChem CID 59113106) has the molecular formula C20H31N3O3S and a molecular weight of 393.55 g/mol. Its IUPAC name is (4S)-N-(2-methyl-4-nitrophenyl)-4-[(1S)-1-[(2-methylpropan-2-yl)oxy]ethyl]-3-(2-methylpropyl)-1,3-thiazolidin-2-imine.
| Compound Name | (4S)-N-(2-methyl-4-nitrophenyl)-4-[(1S)-1-[(2-methylpropan-2-yl)oxy]ethyl]-3-(2-methylpropyl)-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 59113106 |
| Molecular Formula | C20H31N3O3S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | (4S)-N-(2-methyl-4-nitrophenyl)-4-[(1S)-1-[(2-methylpropan-2-yl)oxy]ethyl]-3-(2-methylpropyl)-1,3-thiazolidin-2-imine |
| SMILES | Cc1cc([N+](=O)[O-])ccc1/N=C1\SC[C@H]([C@H](C)OC(C)(C)C)N1CC(C)C |
| InChI | InChI=1S/C20H31N3O3S/c1-13(2)11-22-18(15(4)26-20(5,6)7)12-27-19(22)21-17-9-8-16(23(24)25)10-14(17)3/h8-10,13,15,18H,11-12H2,1-7H3/b21-19-/t15-,18+/m0/s1 |
| InChIKey | QTXODLHICXDCLP-AJKFJFBCSA-N |
| XLogP | 5.17 |
| TPSA | 67.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|