C19H28N2O2S — CID 57222223
4-[[(4S)-3,4-bis(2-methylpropyl)-1,3-thiazolidin-2-ylidene]amino]-3-methylbenzoic acid (PubChem CID 57222223) has the molecular formula C19H28N2O2S and a molecular weight of 348.51 g/mol. Its IUPAC name is 4-[[(4S)-3,4-bis(2-methylpropyl)-1,3-thiazolidin-2-ylidene]amino]-3-methylbenzoic acid.
| Compound Name | 4-[[(4S)-3,4-bis(2-methylpropyl)-1,3-thiazolidin-2-ylidene]amino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 57222223 |
| Molecular Formula | C19H28N2O2S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 4-[[(4S)-3,4-bis(2-methylpropyl)-1,3-thiazolidin-2-ylidene]amino]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1/N=C1\SC[C@H](CC(C)C)N1CC(C)C |
| InChI | InChI=1S/C19H28N2O2S/c1-12(2)8-16-11-24-19(21(16)10-13(3)4)20-17-7-6-15(18(22)23)9-14(17)5/h6-7,9,12-13,16H,8,10-11H2,1-5H3,(H,22,23)/b20-19-/t16-/m0/s1 |
| InChIKey | ZCFSTVXZGWRAAK-JVMRMLDLSA-N |
| XLogP | 4.80 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|