C17H27N3OS — CID 59113150
(4S)-3,4-bis(2-methylpropyl)-N-(3-methyl-4-pyridinyl)-1-oxo-1,3-thiazolidin-2-imine (PubChem CID 59113150) has the molecular formula C17H27N3OS and a molecular weight of 321.49 g/mol. Its IUPAC name is (4S)-3,4-bis(2-methylpropyl)-N-(3-methyl-4-pyridinyl)-1-oxo-1,3-thiazolidin-2-imine.
| Compound Name | (4S)-3,4-bis(2-methylpropyl)-N-(3-methyl-4-pyridinyl)-1-oxo-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 59113150 |
| Molecular Formula | C17H27N3OS |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | (4S)-3,4-bis(2-methylpropyl)-N-(3-methyl-4-pyridinyl)-1-oxo-1,3-thiazolidin-2-imine |
| SMILES | Cc1cnccc1/N=C1/N(CC(C)C)[C@@H](CC(C)C)CS1=O |
| InChI | InChI=1S/C17H27N3OS/c1-12(2)8-15-11-22(21)17(20(15)10-13(3)4)19-16-6-7-18-9-14(16)5/h6-7,9,12-13,15H,8,10-11H2,1-5H3/b19-17-/t15-,22?/m0/s1 |
| InChIKey | RKEGHYGCUGHRPV-KQFWQWLFSA-N |
| XLogP | 3.51 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|