C15H22ClN3O2S — CID 162032777
(4S)-3-methyl-N-(2-methyl-5-nitrophenyl)-4-(2-methylpropyl)-1,3-thiazolidin-2-imine;hydrochloride (PubChem CID 162032777) has the molecular formula C15H22ClN3O2S and a molecular weight of 343.88 g/mol. Its IUPAC name is (4S)-3-methyl-N-(2-methyl-5-nitrophenyl)-4-(2-methylpropyl)-1,3-thiazolidin-2-imine;hydrochloride.
| Compound Name | (4S)-3-methyl-N-(2-methyl-5-nitrophenyl)-4-(2-methylpropyl)-1,3-thiazolidin-2-imine;hydrochloride |
|---|---|
| PubChem CID | 162032777 |
| Molecular Formula | C15H22ClN3O2S |
| Molecular Weight | 343.88 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | (4S)-3-methyl-N-(2-methyl-5-nitrophenyl)-4-(2-methylpropyl)-1,3-thiazolidin-2-imine;hydrochloride |
| SMILES | Cc1ccc([N+](=O)[O-])cc1/N=C1\SC[C@H](CC(C)C)N1C.Cl |
| InChI | InChI=1S/C15H21N3O2S.ClH/c1-10(2)7-13-9-21-15(17(13)4)16-14-8-12(18(19)20)6-5-11(14)3;/h5-6,8,10,13H,7,9H2,1-4H3;1H/b16-15-;/t13-;/m0./s1 |
| InChIKey | PCFKXSOVQNUUDU-CDRFNTHWSA-N |
| XLogP | 4.41 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.88 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|