C19H27N3O3S — CID 59113086
(1R)-1-[(4S)-3-cyclopentyl-2-(4-nitro-2-propan-2-ylphenyl)imino-1,3-thiazolidin-4-yl]ethanol (PubChem CID 59113086) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is (1R)-1-[(4S)-3-cyclopentyl-2-(4-nitro-2-propan-2-ylphenyl)imino-1,3-thiazolidin-4-yl]ethanol.
| Compound Name | (1R)-1-[(4S)-3-cyclopentyl-2-(4-nitro-2-propan-2-ylphenyl)imino-1,3-thiazolidin-4-yl]ethanol |
|---|---|
| PubChem CID | 59113086 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | (1R)-1-[(4S)-3-cyclopentyl-2-(4-nitro-2-propan-2-ylphenyl)imino-1,3-thiazolidin-4-yl]ethanol |
| SMILES | CC(C)c1cc([N+](=O)[O-])ccc1/N=C1\SC[C@H]([C@@H](C)O)N1C1CCCC1 |
| InChI | InChI=1S/C19H27N3O3S/c1-12(2)16-10-15(22(24)25)8-9-17(16)20-19-21(14-6-4-5-7-14)18(11-26-19)13(3)23/h8-10,12-14,18,23H,4-7,11H2,1-3H3/b20-19-/t13-,18-/m1/s1 |
| InChIKey | NEMCLJQGGKRACC-QUSYRXCKSA-N |
| XLogP | 4.45 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|