C23H37N3O3S — CID 18316486
N-(2,3-dimethyl-4-nitrophenyl)-3-(2-ethylbutyl)-4-[1-[(2-methylpropan-2-yl)oxy]ethyl]-1,3-thiazolidin-2-imine (PubChem CID 18316486) has the molecular formula C23H37N3O3S and a molecular weight of 435.63 g/mol. Its IUPAC name is N-(2,3-dimethyl-4-nitrophenyl)-3-(2-ethylbutyl)-4-[1-[(2-methylpropan-2-yl)oxy]ethyl]-1,3-thiazolidin-2-imine.
| Compound Name | N-(2,3-dimethyl-4-nitrophenyl)-3-(2-ethylbutyl)-4-[1-[(2-methylpropan-2-yl)oxy]ethyl]-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 18316486 |
| Molecular Formula | C23H37N3O3S |
| Molecular Weight | 435.63 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | N-(2,3-dimethyl-4-nitrophenyl)-3-(2-ethylbutyl)-4-[1-[(2-methylpropan-2-yl)oxy]ethyl]-1,3-thiazolidin-2-imine |
| SMILES | CCC(CC)CN1/C(=N/c2ccc([N+](=O)[O-])c(C)c2C)SCC1C(C)OC(C)(C)C |
| InChI | InChI=1S/C23H37N3O3S/c1-9-18(10-2)13-25-21(17(5)29-23(6,7)8)14-30-22(25)24-19-11-12-20(26(27)28)16(4)15(19)3/h11-12,17-18,21H,9-10,13-14H2,1-8H3/b24-22- |
| InChIKey | NSBSOLXFPADBBD-GYHWCHFESA-N |
| XLogP | 6.26 |
| TPSA | 67.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.63 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|