C19H31N3O2 — CID 10268542
N'-(2-methyl-4-nitrophenyl)-N,N-bis(2-methylpropyl)butanimidamide (PubChem CID 10268542) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is N'-(2-methyl-4-nitrophenyl)-N,N-bis(2-methylpropyl)butanimidamide.
| Compound Name | N'-(2-methyl-4-nitrophenyl)-N,N-bis(2-methylpropyl)butanimidamide |
|---|---|
| PubChem CID | 10268542 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | N'-(2-methyl-4-nitrophenyl)-N,N-bis(2-methylpropyl)butanimidamide |
| SMILES | CCC/C(=N\c1ccc([N+](=O)[O-])cc1C)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C19H31N3O2/c1-7-8-19(21(12-14(2)3)13-15(4)5)20-18-10-9-17(22(23)24)11-16(18)6/h9-11,14-15H,7-8,12-13H2,1-6H3/b20-19+ |
| InChIKey | WIQJAKNVORECMQ-FMQUCBEESA-N |
| XLogP | 5.35 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|