C23H16ClN3OS — CID 23762806
4-(1-benzofuran-2-yl)-3-[(3-chlorophenyl)methyl]-N-pyridin-3-yl-1,3-thiazol-2-imine (PubChem CID 23762806) has the molecular formula C23H16ClN3OS and a molecular weight of 417.92 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-3-[(3-chlorophenyl)methyl]-N-pyridin-3-yl-1,3-thiazol-2-imine.
| Compound Name | 4-(1-benzofuran-2-yl)-3-[(3-chlorophenyl)methyl]-N-pyridin-3-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23762806 |
| Molecular Formula | C23H16ClN3OS |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-3-[(3-chlorophenyl)methyl]-N-pyridin-3-yl-1,3-thiazol-2-imine |
| SMILES | Clc1cccc(Cn2c(-c3cc4ccccc4o3)cs/c2=N\c2cccnc2)c1 |
| InChI | InChI=1S/C23H16ClN3OS/c24-18-7-3-5-16(11-18)14-27-20(22-12-17-6-1-2-9-21(17)28-22)15-29-23(27)26-19-8-4-10-25-13-19/h1-13,15H,14H2/b26-23- |
| InChIKey | HWZRHXJUGBLTEO-RWEWTDSWSA-N |
| XLogP | 6.29 |
| TPSA | 43.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|