C22H20N2O2S2 — CID 23740492
N-(4-methoxyphenyl)-3-[(4-methoxyphenyl)methyl]-4-thiophen-2-yl-1,3-thiazol-2-imine (PubChem CID 23740492) has the molecular formula C22H20N2O2S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-3-[(4-methoxyphenyl)methyl]-4-thiophen-2-yl-1,3-thiazol-2-imine.
| Compound Name | N-(4-methoxyphenyl)-3-[(4-methoxyphenyl)methyl]-4-thiophen-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23740492 |
| Molecular Formula | C22H20N2O2S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | N-(4-methoxyphenyl)-3-[(4-methoxyphenyl)methyl]-4-thiophen-2-yl-1,3-thiazol-2-imine |
| SMILES | COc1ccc(Cn2c(-c3cccs3)cs/c2=N\c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H20N2O2S2/c1-25-18-9-5-16(6-10-18)14-24-20(21-4-3-13-27-21)15-28-22(24)23-17-7-11-19(26-2)12-8-17/h3-13,15H,14H2,1-2H3/b23-22- |
| InChIKey | QMQAXAKWJPOCFB-FCQUAONHSA-N |
| XLogP | 5.58 |
| TPSA | 35.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|