C20H23N3S — CID 23996371
4-methyl-N-(4-propan-2-ylphenyl)-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine (PubChem CID 23996371) has the molecular formula C20H23N3S and a molecular weight of 337.49 g/mol. Its IUPAC name is 4-methyl-N-(4-propan-2-ylphenyl)-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine.
| Compound Name | 4-methyl-N-(4-propan-2-ylphenyl)-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23996371 |
| Molecular Formula | C20H23N3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 4-methyl-N-(4-propan-2-ylphenyl)-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine |
| SMILES | Cc1cs/c(=N\c2ccc(C(C)C)cc2)n1CCc1ccccn1 |
| InChI | InChI=1S/C20H23N3S/c1-15(2)17-7-9-19(10-8-17)22-20-23(16(3)14-24-20)13-11-18-6-4-5-12-21-18/h4-10,12,14-15H,11,13H2,1-3H3/b22-20- |
| InChIKey | DUCFSZPBZBTTKI-XDOYNYLZSA-N |
| XLogP | 4.85 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|