C16H22N2S — CID 56972580
N-(4-ethylphenyl)-4-methyl-3-(2-methylpropyl)-1,3-thiazol-2-imine (PubChem CID 56972580) has the molecular formula C16H22N2S and a molecular weight of 274.43 g/mol. Its IUPAC name is N-(4-ethylphenyl)-4-methyl-3-(2-methylpropyl)-1,3-thiazol-2-imine.
| Compound Name | N-(4-ethylphenyl)-4-methyl-3-(2-methylpropyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 56972580 |
| Molecular Formula | C16H22N2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | N-(4-ethylphenyl)-4-methyl-3-(2-methylpropyl)-1,3-thiazol-2-imine |
| SMILES | CCc1ccc(/N=c2\scc(C)n2CC(C)C)cc1 |
| InChI | InChI=1S/C16H22N2S/c1-5-14-6-8-15(9-7-14)17-16-18(10-12(2)3)13(4)11-19-16/h6-9,11-12H,5,10H2,1-4H3/b17-16- |
| InChIKey | LOMJCQDXIBXFKB-MSUUIHNZSA-N |
| XLogP | 4.31 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|