C22H23N5OS — CID 23821574
1,5-dimethyl-4-[[4-methyl-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-ylidene]amino]-2-phenylpyrazol-3-one (PubChem CID 23821574) has the molecular formula C22H23N5OS and a molecular weight of 405.53 g/mol. Its IUPAC name is 1,5-dimethyl-4-[[4-methyl-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-ylidene]amino]-2-phenylpyrazol-3-one.
| Compound Name | 1,5-dimethyl-4-[[4-methyl-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-ylidene]amino]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 23821574 |
| Molecular Formula | C22H23N5OS |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 1,5-dimethyl-4-[[4-methyl-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-ylidene]amino]-2-phenylpyrazol-3-one |
| SMILES | Cc1cs/c(=N\c2c(C)n(C)n(-c3ccccc3)c2=O)n1CCc1ccccn1 |
| InChI | InChI=1S/C22H23N5OS/c1-16-15-29-22(26(16)14-12-18-9-7-8-13-23-18)24-20-17(2)25(3)27(21(20)28)19-10-5-4-6-11-19/h4-11,13,15H,12,14H2,1-3H3/b24-22- |
| InChIKey | YYRQDJIEPZVAIY-GYHWCHFESA-N |
| XLogP | 3.53 |
| TPSA | 57.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|