C14H7Br2NO3 — CID 158205454
1-(3,5-dibromo-4-hydroxyphenyl)indole-2,3-dione (PubChem CID 158205454) has the molecular formula C14H7Br2NO3 and a molecular weight of 397.02 g/mol. Its IUPAC name is 1-(3,5-dibromo-4-hydroxyphenyl)indole-2,3-dione.
| Compound Name | 1-(3,5-dibromo-4-hydroxyphenyl)indole-2,3-dione |
|---|---|
| PubChem CID | 158205454 |
| Molecular Formula | C14H7Br2NO3 |
| Molecular Weight | 397.02 g/mol |
| Exact Mass | 394.88 |
| IUPAC Name | 1-(3,5-dibromo-4-hydroxyphenyl)indole-2,3-dione |
| SMILES | O=C1C(=O)N(c2cc(Br)c(O)c(Br)c2)c2ccccc21 |
| InChI | InChI=1S/C14H7Br2NO3/c15-9-5-7(6-10(16)13(9)19)17-11-4-2-1-3-8(11)12(18)14(17)20/h1-6,19H |
| InChIKey | GBLDMGWFXGNYJT-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.02 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|