C15H8Cl3NO3 — CID 158219593
1-[4-hydroxy-3-(trichloromethyl)phenyl]indole-2,3-dione (PubChem CID 158219593) has the molecular formula C15H8Cl3NO3 and a molecular weight of 356.59 g/mol. Its IUPAC name is 1-[4-hydroxy-3-(trichloromethyl)phenyl]indole-2,3-dione.
| Compound Name | 1-[4-hydroxy-3-(trichloromethyl)phenyl]indole-2,3-dione |
|---|---|
| PubChem CID | 158219593 |
| Molecular Formula | C15H8Cl3NO3 |
| Molecular Weight | 356.59 g/mol |
| Exact Mass | 354.96 |
| IUPAC Name | 1-[4-hydroxy-3-(trichloromethyl)phenyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(c2ccc(O)c(C(Cl)(Cl)Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C15H8Cl3NO3/c16-15(17,18)10-7-8(5-6-12(10)20)19-11-4-2-1-3-9(11)13(21)14(19)22/h1-7,20H |
| InChIKey | GDBUEKSDIPKIJC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|