C20H22NO6P — CID 53360761
(4R,5R)-4-diethoxyphosphoryl-9-methoxy-12-oxa-2-azatetracyclo[11.4.0.02,5.06,11]heptadeca-1(17),6(11),7,9,13,15-hexaen-3-one (PubChem CID 53360761) has the molecular formula C20H22NO6P and a molecular weight of 403.37 g/mol. Its IUPAC name is (4R,5R)-4-diethoxyphosphoryl-9-methoxy-12-oxa-2-azatetracyclo[11.4.0.02,5.06,11]heptadeca-1(17),6(11),7,9,13,15-hexaen-3-one.
| Compound Name | (4R,5R)-4-diethoxyphosphoryl-9-methoxy-12-oxa-2-azatetracyclo[11.4.0.02,5.06,11]heptadeca-1(17),6(11),7,9,13,15-hexaen-3-one |
|---|---|
| PubChem CID | 53360761 |
| Molecular Formula | C20H22NO6P |
| Molecular Weight | 403.37 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | (4R,5R)-4-diethoxyphosphoryl-9-methoxy-12-oxa-2-azatetracyclo[11.4.0.02,5.06,11]heptadeca-1(17),6(11),7,9,13,15-hexaen-3-one |
| SMILES | CCOP(=O)(OCC)[C@H]1C(=O)N2c3ccccc3Oc3cc(OC)ccc3[C@H]12 |
| InChI | InChI=1S/C20H22NO6P/c1-4-25-28(23,26-5-2)19-18-14-11-10-13(24-3)12-17(14)27-16-9-7-6-8-15(16)21(18)20(19)22/h6-12,18-19H,4-5H2,1-3H3/t18-,19-/m1/s1 |
| InChIKey | QBIUQYAGAQIRJQ-RTBURBONSA-N |
| XLogP | 4.52 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|