C16H25N2O6P — CID 71719553
(3R,5R)-3-diethoxyphosphoryl-N-(3-methoxyphenyl)-2-methyl-1,2-oxazolidine-5-carboxamide (PubChem CID 71719553) has the molecular formula C16H25N2O6P and a molecular weight of 372.36 g/mol. Its IUPAC name is (3R,5R)-3-diethoxyphosphoryl-N-(3-methoxyphenyl)-2-methyl-1,2-oxazolidine-5-carboxamide.
| Compound Name | (3R,5R)-3-diethoxyphosphoryl-N-(3-methoxyphenyl)-2-methyl-1,2-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 71719553 |
| Molecular Formula | C16H25N2O6P |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (3R,5R)-3-diethoxyphosphoryl-N-(3-methoxyphenyl)-2-methyl-1,2-oxazolidine-5-carboxamide |
| SMILES | CCOP(=O)(OCC)[C@@H]1C[C@H](C(=O)Nc2cccc(OC)c2)ON1C |
| InChI | InChI=1S/C16H25N2O6P/c1-5-22-25(20,23-6-2)15-11-14(24-18(15)3)16(19)17-12-8-7-9-13(10-12)21-4/h7-10,14-15H,5-6,11H2,1-4H3,(H,17,19)/t14-,15-/m1/s1 |
| InChIKey | ZIAGXSBUFFBTEU-HUUCEWRRSA-N |
| XLogP | 2.86 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|