C7H10O5 — CID 130466601
(4S,5S)-6-ethynyloxane-2,3,4,5-tetrol (PubChem CID 130466601) has the molecular formula C7H10O5 and a molecular weight of 174.15 g/mol. Its IUPAC name is (4S,5S)-6-ethynyloxane-2,3,4,5-tetrol.
| Compound Name | (4S,5S)-6-ethynyloxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 130466601 |
| Molecular Formula | C7H10O5 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | (4S,5S)-6-ethynyloxane-2,3,4,5-tetrol |
| SMILES | C#CC1OC(O)C(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H10O5/c1-2-3-4(8)5(9)6(10)7(11)12-3/h1,3-11H/t3?,4-,5+,6?,7?/m1/s1 |
| InChIKey | CZNHMTJHTGBOTL-UWOHFWNMSA-N |
| XLogP | -2.58 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|