C10H16O5 — CID 88893455
(3S,4S,6R)-2-ethynyl-6-propan-2-yloxyoxane-3,4,5-triol (PubChem CID 88893455) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is (3S,4S,6R)-2-ethynyl-6-propan-2-yloxyoxane-3,4,5-triol.
| Compound Name | (3S,4S,6R)-2-ethynyl-6-propan-2-yloxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 88893455 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | (3S,4S,6R)-2-ethynyl-6-propan-2-yloxyoxane-3,4,5-triol |
| SMILES | C#CC1O[C@@H](OC(C)C)C(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H16O5/c1-4-6-7(11)8(12)9(13)10(15-6)14-5(2)3/h1,5-13H,2-3H3/t6?,7-,8+,9?,10-/m1/s1 |
| InChIKey | CHQNPGTZGLEXLY-URESZAIDSA-N |
| XLogP | -1.15 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|