C10H18O4 — CID 166730220
2-propan-2-yloxy-5-prop-1-en-2-yloxolane-3,4-diol (PubChem CID 166730220) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is 2-propan-2-yloxy-5-prop-1-en-2-yloxolane-3,4-diol.
| Compound Name | 2-propan-2-yloxy-5-prop-1-en-2-yloxolane-3,4-diol |
|---|---|
| PubChem CID | 166730220 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 2-propan-2-yloxy-5-prop-1-en-2-yloxolane-3,4-diol |
| SMILES | C=C(C)C1OC(OC(C)C)C(O)C1O |
| InChI | InChI=1S/C10H18O4/c1-5(2)9-7(11)8(12)10(14-9)13-6(3)4/h6-12H,1H2,2-4H3 |
| InChIKey | AQLFYSODGQVDRR-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|