C10H12O4 — CID 131002864
(2S,3S,4S,5S,6S)-2,5-diethynyl-6-(hydroxymethyl)oxane-3,4-diol (PubChem CID 131002864) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is (2S,3S,4S,5S,6S)-2,5-diethynyl-6-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2S,3S,4S,5S,6S)-2,5-diethynyl-6-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 131002864 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (2S,3S,4S,5S,6S)-2,5-diethynyl-6-(hydroxymethyl)oxane-3,4-diol |
| SMILES | C#C[C@H]1[C@H](O)[C@H](O)[C@H](C#C)O[C@@H]1CO |
| InChI | InChI=1S/C10H12O4/c1-3-6-8(5-11)14-7(4-2)10(13)9(6)12/h1-2,6-13H,5H2/t6-,7+,8-,9+,10-/m1/s1 |
| InChIKey | KGWCVFUVHYJZAZ-MQIGXGKASA-N |
| XLogP | -1.65 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|