C10H14O4 — CID 130990439
[(3aR,5S,6S,6aR)-6-ethynyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methanol (PubChem CID 130990439) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is [(3aR,5S,6S,6aR)-6-ethynyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methanol.
| Compound Name | [(3aR,5S,6S,6aR)-6-ethynyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methanol |
|---|---|
| PubChem CID | 130990439 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | [(3aR,5S,6S,6aR)-6-ethynyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methanol |
| SMILES | C#C[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1CO |
| InChI | InChI=1S/C10H14O4/c1-4-6-7(5-11)12-9-8(6)13-10(2,3)14-9/h1,6-9,11H,5H2,2-3H3/t6-,7+,8+,9+/m0/s1 |
| InChIKey | VNYMVXSJUYDTLM-JQCXWYLXSA-N |
| XLogP | 0.10 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|