C22H34N2O8 — CID 176556176
methyl (2E,4E)-5-[(2R,5S)-6-[[(2-cyanoacetyl)amino]methyl]-3,4,5-trihydroxyoxan-2-yl]oxy-2-methylhepta-2,4,6-trienoate;2-methylpropane (PubChem CID 176556176) has the molecular formula C22H34N2O8 and a molecular weight of 454.52 g/mol. Its IUPAC name is methyl (2E,4E)-5-[(2R,5S)-6-[[(2-cyanoacetyl)amino]methyl]-3,4,5-trihydroxyoxan-2-yl]oxy-2-methylhepta-2,4,6-trienoate;2-methylpropane.
| Compound Name | methyl (2E,4E)-5-[(2R,5S)-6-[[(2-cyanoacetyl)amino]methyl]-3,4,5-trihydroxyoxan-2-yl]oxy-2-methylhepta-2,4,6-trienoate;2-methylpropane |
|---|---|
| PubChem CID | 176556176 |
| Molecular Formula | C22H34N2O8 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | methyl (2E,4E)-5-[(2R,5S)-6-[[(2-cyanoacetyl)amino]methyl]-3,4,5-trihydroxyoxan-2-yl]oxy-2-methylhepta-2,4,6-trienoate;2-methylpropane |
| SMILES | C=C/C(=C\C=C(/C)C(=O)OC)O[C@H]1OC(CNC(=O)CC#N)[C@@H](O)C(O)C1O.CC(C)C |
| InChI | InChI=1S/C18H24N2O8.C4H10/c1-4-11(6-5-10(2)17(25)26-3)27-18-16(24)15(23)14(22)12(28-18)9-20-13(21)7-8-19;1-4(2)3/h4-6,12,14-16,18,22-24H,1,7,9H2,2-3H3,(H,20,21);4H,1-3H3/b10-5+,11-6+;/t12?,14-,15?,16?,18+;/m1./s1 |
| InChIKey | FICZTUTYPDKKTM-AQUDZAOUSA-N |
| XLogP | 0.69 |
| TPSA | 158.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|