C23H41N3O9 — CID 146393868
(4S)-4-[[(2S)-3-methyl-2-(pentanoylamino)butanoyl]amino]-5-oxo-N-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]hexanamide (PubChem CID 146393868) has the molecular formula C23H41N3O9 and a molecular weight of 503.59 g/mol. Its IUPAC name is (4S)-4-[[(2S)-3-methyl-2-(pentanoylamino)butanoyl]amino]-5-oxo-N-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]hexanamide.
| Compound Name | (4S)-4-[[(2S)-3-methyl-2-(pentanoylamino)butanoyl]amino]-5-oxo-N-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]hexanamide |
|---|---|
| PubChem CID | 146393868 |
| Molecular Formula | C23H41N3O9 |
| Molecular Weight | 503.59 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | (4S)-4-[[(2S)-3-methyl-2-(pentanoylamino)butanoyl]amino]-5-oxo-N-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]hexanamide |
| SMILES | CCCCC(=O)N[C@H](C(=O)N[C@@H](CCC(=O)NC[C@H]1O[C@@H](OC)[C@H](O)[C@@H](O)[C@@H]1O)C(C)=O)C(C)C |
| InChI | InChI=1S/C23H41N3O9/c1-6-7-8-17(29)26-18(12(2)3)22(33)25-14(13(4)27)9-10-16(28)24-11-15-19(30)20(31)21(32)23(34-5)35-15/h12,14-15,18-21,23,30-32H,6-11H2,1-5H3,(H,24,28)(H,25,33)(H,26,29)/t14-,15+,18-,19+,20-,21+,23+/m0/s1 |
| InChIKey | YJYVMSRGRGRHIC-YKEAKUSESA-N |
| XLogP | -1.26 |
| TPSA | 183.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.59 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |