C17H30N4O5 — CID 156544596
(2S)-N-[(3S)-6-(carbamoylamino)-2-oxohexan-3-yl]-3-methyl-2-(4-oxopentanoylamino)butanamide (PubChem CID 156544596) has the molecular formula C17H30N4O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is (2S)-N-[(3S)-6-(carbamoylamino)-2-oxohexan-3-yl]-3-methyl-2-(4-oxopentanoylamino)butanamide.
| Compound Name | (2S)-N-[(3S)-6-(carbamoylamino)-2-oxohexan-3-yl]-3-methyl-2-(4-oxopentanoylamino)butanamide |
|---|---|
| PubChem CID | 156544596 |
| Molecular Formula | C17H30N4O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | (2S)-N-[(3S)-6-(carbamoylamino)-2-oxohexan-3-yl]-3-methyl-2-(4-oxopentanoylamino)butanamide |
| SMILES | CC(=O)CCC(=O)N[C@H](C(=O)N[C@@H](CCCNC(N)=O)C(C)=O)C(C)C |
| InChI | InChI=1S/C17H30N4O5/c1-10(2)15(21-14(24)8-7-11(3)22)16(25)20-13(12(4)23)6-5-9-19-17(18)26/h10,13,15H,5-9H2,1-4H3,(H,20,25)(H,21,24)(H3,18,19,26)/t13-,15-/m0/s1 |
| InChIKey | WWIIDBCWMLMTDX-ZFWWWQNUSA-N |
| XLogP | 0.02 |
| TPSA | 147.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|