C16H24O3 — CID 123217834
methyl 5-ethenyl-2,6,7-trimethyl-9-oxodeca-2,4-dienoate (PubChem CID 123217834) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is methyl 5-ethenyl-2,6,7-trimethyl-9-oxodeca-2,4-dienoate.
| Compound Name | methyl 5-ethenyl-2,6,7-trimethyl-9-oxodeca-2,4-dienoate |
|---|---|
| PubChem CID | 123217834 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | methyl 5-ethenyl-2,6,7-trimethyl-9-oxodeca-2,4-dienoate |
| SMILES | C=CC(=CC=C(C)C(=O)OC)C(C)C(C)CC(C)=O |
| InChI | InChI=1S/C16H24O3/c1-7-15(9-8-11(2)16(18)19-6)14(5)12(3)10-13(4)17/h7-9,12,14H,1,10H2,2-6H3 |
| InChIKey | MIMZHGRHRDGTMW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|