C17H27N2O9P — CID 168749692
2-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-[4-(propan-2-ylcarbamoylamino)phenoxy]oxan-2-yl]ethylphosphonic acid (PubChem CID 168749692) has the molecular formula C17H27N2O9P and a molecular weight of 434.38 g/mol. Its IUPAC name is 2-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-[4-(propan-2-ylcarbamoylamino)phenoxy]oxan-2-yl]ethylphosphonic acid.
| Compound Name | 2-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-[4-(propan-2-ylcarbamoylamino)phenoxy]oxan-2-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 168749692 |
| Molecular Formula | C17H27N2O9P |
| Molecular Weight | 434.38 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 2-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-[4-(propan-2-ylcarbamoylamino)phenoxy]oxan-2-yl]ethylphosphonic acid |
| SMILES | CC(C)NC(=O)Nc1ccc(O[C@H]2O[C@H](CCP(=O)(O)O)[C@@H](O)[C@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C17H27N2O9P/c1-9(2)18-17(23)19-10-3-5-11(6-4-10)27-16-15(22)14(21)13(20)12(28-16)7-8-29(24,25)26/h3-6,9,12-16,20-22H,7-8H2,1-2H3,(H2,18,19,23)(H2,24,25,26)/t12-,13-,14+,15+,16+/m1/s1 |
| InChIKey | PUSOLCVJKZQWJX-OWYFMNJBSA-N |
| XLogP | -0.03 |
| TPSA | 177.81 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.38 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|