C15H19NO7 — CID 67135520
N-[4-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enamide (PubChem CID 67135520) has the molecular formula C15H19NO7 and a molecular weight of 325.32 g/mol. Its IUPAC name is N-[4-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enamide.
| Compound Name | N-[4-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 67135520 |
| Molecular Formula | C15H19NO7 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N-[4-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(OC2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C15H19NO7/c1-2-11(18)16-8-3-5-9(6-4-8)22-15-14(21)13(20)12(19)10(7-17)23-15/h2-6,10,12-15,17,19-21H,1,7H2,(H,16,18)/t10-,12+,13+,14-,15?/m1/s1 |
| InChIKey | DVUNHWYOMDGXMI-QLABQVJUSA-N |
| XLogP | -1.01 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|