C25H32N2O12S — CID 101044992
1,3-bis[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]thiourea (PubChem CID 101044992) has the molecular formula C25H32N2O12S and a molecular weight of 584.60 g/mol. Its IUPAC name is 1,3-bis[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]thiourea.
| Compound Name | 1,3-bis[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]thiourea |
|---|---|
| PubChem CID | 101044992 |
| Molecular Formula | C25H32N2O12S |
| Molecular Weight | 584.60 g/mol |
| Exact Mass | 584.17 |
| IUPAC Name | 1,3-bis[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]thiourea |
| SMILES | OC[C@H]1O[C@H](Oc2ccc(NC(=S)Nc3ccc(O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O)cc3)cc2)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H32N2O12S/c28-9-15-17(30)19(32)21(34)23(38-15)36-13-5-1-11(2-6-13)26-25(40)27-12-3-7-14(8-4-12)37-24-22(35)20(33)18(31)16(10-29)39-24/h1-8,15-24,28-35H,9-10H2,(H2,26,27,40)/t15-,16-,17-,18-,19+,20+,21+,22+,23+,24+/m1/s1 |
| InChIKey | BXEUOPRHZGWVLE-PUYHWVFISA-N |
| XLogP | -2.15 |
| TPSA | 222.82 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.60 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|