C10H18O7 — CID 160711349
[(3S,4R,5R,6R)-3,4,5-trihydroxy-6-[(2-methylpropan-2-yl)oxy]oxan-2-yl] formate (PubChem CID 160711349) has the molecular formula C10H18O7 and a molecular weight of 250.25 g/mol. Its IUPAC name is [(3S,4R,5R,6R)-3,4,5-trihydroxy-6-[(2-methylpropan-2-yl)oxy]oxan-2-yl] formate.
| Compound Name | [(3S,4R,5R,6R)-3,4,5-trihydroxy-6-[(2-methylpropan-2-yl)oxy]oxan-2-yl] formate |
|---|---|
| PubChem CID | 160711349 |
| Molecular Formula | C10H18O7 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | [(3S,4R,5R,6R)-3,4,5-trihydroxy-6-[(2-methylpropan-2-yl)oxy]oxan-2-yl] formate |
| SMILES | CC(C)(C)O[C@@H]1OC(OC=O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H18O7/c1-10(2,3)17-9-7(14)5(12)6(13)8(16-9)15-4-11/h4-9,12-14H,1-3H3/t5-,6-,7+,8?,9-/m0/s1 |
| InChIKey | HGIKVNQCTRNUTL-DADKVEHESA-N |
| XLogP | -1.26 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|