C11H20O6 — CID 175622893
[(2S,3R,4S,5S)-3,5-dihydroxy-4-methyl-6-[(2-methylpropan-2-yl)oxy]oxan-2-yl] formate (PubChem CID 175622893) has the molecular formula C11H20O6 and a molecular weight of 248.27 g/mol. Its IUPAC name is [(2S,3R,4S,5S)-3,5-dihydroxy-4-methyl-6-[(2-methylpropan-2-yl)oxy]oxan-2-yl] formate.
| Compound Name | [(2S,3R,4S,5S)-3,5-dihydroxy-4-methyl-6-[(2-methylpropan-2-yl)oxy]oxan-2-yl] formate |
|---|---|
| PubChem CID | 175622893 |
| Molecular Formula | C11H20O6 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | [(2S,3R,4S,5S)-3,5-dihydroxy-4-methyl-6-[(2-methylpropan-2-yl)oxy]oxan-2-yl] formate |
| SMILES | C[C@@H]1[C@@H](O)[C@H](OC=O)OC(OC(C)(C)C)[C@H]1O |
| InChI | InChI=1S/C11H20O6/c1-6-7(13)9(15-5-12)16-10(8(6)14)17-11(2,3)4/h5-10,13-14H,1-4H3/t6-,7-,8+,9-,10?/m1/s1 |
| InChIKey | LYFQMKLMSBMXJD-ZKZCYXTQSA-N |
| XLogP | 0.01 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|