C14H31N3O4 — CID 122629741
(2R,3S,4S,5S,6S)-4-[bis(2-aminoethyl)amino]-2-methyl-6-[(2-methylpropan-2-yl)oxy]oxane-3,5-diol (PubChem CID 122629741) has the molecular formula C14H31N3O4 and a molecular weight of 305.42 g/mol. Its IUPAC name is (2R,3S,4S,5S,6S)-4-[bis(2-aminoethyl)amino]-2-methyl-6-[(2-methylpropan-2-yl)oxy]oxane-3,5-diol.
| Compound Name | (2R,3S,4S,5S,6S)-4-[bis(2-aminoethyl)amino]-2-methyl-6-[(2-methylpropan-2-yl)oxy]oxane-3,5-diol |
|---|---|
| PubChem CID | 122629741 |
| Molecular Formula | C14H31N3O4 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.23 |
| IUPAC Name | (2R,3S,4S,5S,6S)-4-[bis(2-aminoethyl)amino]-2-methyl-6-[(2-methylpropan-2-yl)oxy]oxane-3,5-diol |
| SMILES | C[C@H]1O[C@@H](OC(C)(C)C)[C@@H](O)[C@@H](N(CCN)CCN)[C@@H]1O |
| InChI | InChI=1S/C14H31N3O4/c1-9-11(18)10(17(7-5-15)8-6-16)12(19)13(20-9)21-14(2,3)4/h9-13,18-19H,5-8,15-16H2,1-4H3/t9-,10+,11-,12+,13+/m1/s1 |
| InChIKey | ZVLFEKRUJLPUHG-FHUSYTEZSA-N |
| XLogP | -1.14 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |