C11H23N3O4 — CID 122629742
2-[(2R,3S,4S,5S,6S)-3,5-dihydroxy-2-methyl-6-[(2-methylpropan-2-yl)oxy]oxan-4-yl]guanidine (PubChem CID 122629742) has the molecular formula C11H23N3O4 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-[(2R,3S,4S,5S,6S)-3,5-dihydroxy-2-methyl-6-[(2-methylpropan-2-yl)oxy]oxan-4-yl]guanidine.
| Compound Name | 2-[(2R,3S,4S,5S,6S)-3,5-dihydroxy-2-methyl-6-[(2-methylpropan-2-yl)oxy]oxan-4-yl]guanidine |
|---|---|
| PubChem CID | 122629742 |
| Molecular Formula | C11H23N3O4 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 2-[(2R,3S,4S,5S,6S)-3,5-dihydroxy-2-methyl-6-[(2-methylpropan-2-yl)oxy]oxan-4-yl]guanidine |
| SMILES | C[C@H]1O[C@@H](OC(C)(C)C)[C@@H](O)[C@@H](N=C(N)N)[C@@H]1O |
| InChI | InChI=1S/C11H23N3O4/c1-5-7(15)6(14-10(12)13)8(16)9(17-5)18-11(2,3)4/h5-9,15-16H,1-4H3,(H4,12,13,14)/t5-,6+,7-,8+,9+/m1/s1 |
| InChIKey | STBXMQGHVPQVLX-DMAGGPPCSA-N |
| XLogP | -1.09 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|