C8H17N3O4 — CID 122634490
2-[(3S,4S,6R)-3,5-dihydroxy-2-methoxy-6-methyloxan-4-yl]guanidine (PubChem CID 122634490) has the molecular formula C8H17N3O4 and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-[(3S,4S,6R)-3,5-dihydroxy-2-methoxy-6-methyloxan-4-yl]guanidine.
| Compound Name | 2-[(3S,4S,6R)-3,5-dihydroxy-2-methoxy-6-methyloxan-4-yl]guanidine |
|---|---|
| PubChem CID | 122634490 |
| Molecular Formula | C8H17N3O4 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 2-[(3S,4S,6R)-3,5-dihydroxy-2-methoxy-6-methyloxan-4-yl]guanidine |
| SMILES | COC1O[C@H](C)C(O)[C@H](N=C(N)N)[C@@H]1O |
| InChI | InChI=1S/C8H17N3O4/c1-3-5(12)4(11-8(9)10)6(13)7(14-2)15-3/h3-7,12-13H,1-2H3,(H4,9,10,11)/t3-,4+,5?,6+,7?/m1/s1 |
| InChIKey | JWHQQSKPFCJCRN-LGLYULGQSA-N |
| XLogP | -2.26 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|