C7H13ClO4 — CID 130765052
(2R,3S,4R,5R,6R)-4-chloro-2-methoxy-6-methyloxane-3,5-diol (PubChem CID 130765052) has the molecular formula C7H13ClO4 and a molecular weight of 196.63 g/mol. Its IUPAC name is (2R,3S,4R,5R,6R)-4-chloro-2-methoxy-6-methyloxane-3,5-diol.
| Compound Name | (2R,3S,4R,5R,6R)-4-chloro-2-methoxy-6-methyloxane-3,5-diol |
|---|---|
| PubChem CID | 130765052 |
| Molecular Formula | C7H13ClO4 |
| Molecular Weight | 196.63 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | (2R,3S,4R,5R,6R)-4-chloro-2-methoxy-6-methyloxane-3,5-diol |
| SMILES | CO[C@@H]1O[C@H](C)[C@@H](O)[C@@H](Cl)[C@H]1O |
| InChI | InChI=1S/C7H13ClO4/c1-3-5(9)4(8)6(10)7(11-2)12-3/h3-7,9-10H,1-2H3/t3-,4-,5-,6-,7-/m1/s1 |
| InChIKey | WOKLFXNLYXNSAX-NYMZXIIRSA-N |
| XLogP | -0.29 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.63 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|