C7H12O7 — CID 58513034
(4,5,6-trihydroxy-3-methoxyoxan-2-yl) formate (PubChem CID 58513034) has the molecular formula C7H12O7 and a molecular weight of 208.17 g/mol. Its IUPAC name is (4,5,6-trihydroxy-3-methoxyoxan-2-yl) formate.
| Compound Name | (4,5,6-trihydroxy-3-methoxyoxan-2-yl) formate |
|---|---|
| PubChem CID | 58513034 |
| Molecular Formula | C7H12O7 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | (4,5,6-trihydroxy-3-methoxyoxan-2-yl) formate |
| SMILES | COC1C(OC=O)OC(O)C(O)C1O |
| InChI | InChI=1S/C7H12O7/c1-12-5-3(9)4(10)6(11)14-7(5)13-2-8/h2-7,9-11H,1H3 |
| InChIKey | BHPOUTPEGKVMCQ-UHFFFAOYSA-N |
| XLogP | -2.43 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|